C25H21ClFN5O — CID 67267455
N-[1-(6-chloroquinazolin-4-yl)piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide (PubChem CID 67267455) has the molecular formula C25H21ClFN5O and a molecular weight of 461.93 g/mol. Its IUPAC name is N-[1-(6-chloroquinazolin-4-yl)piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | N-[1-(6-chloroquinazolin-4-yl)piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67267455 |
| Molecular Formula | C25H21ClFN5O |
| Molecular Weight | 461.93 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | N-[1-(6-chloroquinazolin-4-yl)piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(c2ncnc3ccc(Cl)cc23)CC1)c1ccc(-c2cccc(F)c2)nc1 |
| InChI | InChI=1S/C25H21ClFN5O/c26-18-5-7-23-21(13-18)24(30-15-29-23)32-10-8-20(9-11-32)31-25(33)17-4-6-22(28-14-17)16-2-1-3-19(27)12-16/h1-7,12-15,20H,8-11H2,(H,31,33) |
| InChIKey | LDOBNPJDYKNZLG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.93 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |