C22H27FN4O3 — CID 67267712
4-[4-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]piperidin-1-yl]butylcarbamic acid (PubChem CID 67267712) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-[4-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]piperidin-1-yl]butylcarbamic acid.
| Compound Name | 4-[4-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]piperidin-1-yl]butylcarbamic acid |
|---|---|
| PubChem CID | 67267712 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 4-[4-[[6-(3-fluorophenyl)pyridine-3-carbonyl]amino]piperidin-1-yl]butylcarbamic acid |
| SMILES | O=C(O)NCCCCN1CCC(NC(=O)c2ccc(-c3cccc(F)c3)nc2)CC1 |
| InChI | InChI=1S/C22H27FN4O3/c23-18-5-3-4-16(14-18)20-7-6-17(15-25-20)21(28)26-19-8-12-27(13-9-19)11-2-1-10-24-22(29)30/h3-7,14-15,19,24H,1-2,8-13H2,(H,26,28)(H,29,30) |
| InChIKey | WQBIARWOKCBMTJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|