C24H28FN3O — CID 67268177
N-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide (PubChem CID 67268177) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | N-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67268177 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(CC2CC=CCC2)CC1)c1ccc(-c2cccc(F)c2)nc1 |
| InChI | InChI=1S/C24H28FN3O/c25-21-8-4-7-19(15-21)23-10-9-20(16-26-23)24(29)27-22-11-13-28(14-12-22)17-18-5-2-1-3-6-18/h1-2,4,7-10,15-16,18,22H,3,5-6,11-14,17H2,(H,27,29) |
| InChIKey | RWGODLRQDDRVSI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|