C25H23FN4O — CID 67268195
N-[1-[(2-cyanophenyl)methyl]piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide (PubChem CID 67268195) has the molecular formula C25H23FN4O and a molecular weight of 414.48 g/mol. Its IUPAC name is N-[1-[(2-cyanophenyl)methyl]piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide.
| Compound Name | N-[1-[(2-cyanophenyl)methyl]piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67268195 |
| Molecular Formula | C25H23FN4O |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[1-[(2-cyanophenyl)methyl]piperidin-4-yl]-6-(3-fluorophenyl)pyridine-3-carboxamide |
| SMILES | N#Cc1ccccc1CN1CCC(NC(=O)c2ccc(-c3cccc(F)c3)nc2)CC1 |
| InChI | InChI=1S/C25H23FN4O/c26-22-7-3-6-18(14-22)24-9-8-20(16-28-24)25(31)29-23-10-12-30(13-11-23)17-21-5-2-1-4-19(21)15-27/h1-9,14,16,23H,10-13,17H2,(H,29,31) |
| InChIKey | UDJIVIXXWNEDCU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |