C15H20ClNO5 — CID 67268964
methyl (2R)-3-(1-chloropropan-2-yloxy)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 67268964) has the molecular formula C15H20ClNO5 and a molecular weight of 329.78 g/mol. Its IUPAC name is methyl (2R)-3-(1-chloropropan-2-yloxy)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl (2R)-3-(1-chloropropan-2-yloxy)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 67268964 |
| Molecular Formula | C15H20ClNO5 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | methyl (2R)-3-(1-chloropropan-2-yloxy)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@@H](COC(C)CCl)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20ClNO5/c1-11(8-16)21-10-13(14(18)20-2)17-15(19)22-9-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H,17,19)/t11?,13-/m1/s1 |
| InChIKey | QKAXVMCPOMRXRQ-GLGOKHISSA-N |
| XLogP | 2.10 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|