C18H25NO2 — CID 67269330
10-hexyl-4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-2(6)-ene-3,5-dione (PubChem CID 67269330) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 10-hexyl-4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-2(6)-ene-3,5-dione.
| Compound Name | 10-hexyl-4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-2(6)-ene-3,5-dione |
|---|---|
| PubChem CID | 67269330 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 10-hexyl-4-prop-2-enyl-4-azatricyclo[5.2.1.02,6]dec-2(6)-ene-3,5-dione |
| SMILES | C=CCN1C(=O)C2=C(C1=O)C1CCC2C1CCCCCC |
| InChI | InChI=1S/C18H25NO2/c1-3-5-6-7-8-12-13-9-10-14(12)16-15(13)17(20)19(11-4-2)18(16)21/h4,12-14H,2-3,5-11H2,1H3 |
| InChIKey | FMVLDGOKZOMKOD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|