C17H23NO3 — CID 87332232
11-pentyl-4-prop-2-enyl-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione (PubChem CID 87332232) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is 11-pentyl-4-prop-2-enyl-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione.
| Compound Name | 11-pentyl-4-prop-2-enyl-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
|---|---|
| PubChem CID | 87332232 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 11-pentyl-4-prop-2-enyl-9-oxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
| SMILES | C=CCN1C(=O)C2C(C1=O)C1C(CCCCC)C2C2OC21 |
| InChI | InChI=1S/C17H23NO3/c1-3-5-6-7-9-10-12-13(11(9)15-14(10)21-15)17(20)18(8-4-2)16(12)19/h4,9-15H,2-3,5-8H2,1H3 |
| InChIKey | HIUOTFWTIBSVSI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|