C14H11N3O — CID 67273315
(5-aminoimidazo[1,2-a]pyridin-2-yl)-phenylmethanone (PubChem CID 67273315) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is (5-aminoimidazo[1,2-a]pyridin-2-yl)-phenylmethanone.
| Compound Name | (5-aminoimidazo[1,2-a]pyridin-2-yl)-phenylmethanone |
|---|---|
| PubChem CID | 67273315 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | (5-aminoimidazo[1,2-a]pyridin-2-yl)-phenylmethanone |
| SMILES | Nc1cccc2nc(C(=O)c3ccccc3)cn12 |
| InChI | InChI=1S/C14H11N3O/c15-12-7-4-8-13-16-11(9-17(12)13)14(18)10-5-2-1-3-6-10/h1-9H,15H2 |
| InChIKey | MGEMOVBUCBXEHG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |