C27H31FN4O2 — CID 67274301
N-[[(2S)-1,4-dibenzylpiperazin-2-yl]methyl]-N-ethyl-2-fluoro-4-nitroaniline (PubChem CID 67274301) has the molecular formula C27H31FN4O2 and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[[(2S)-1,4-dibenzylpiperazin-2-yl]methyl]-N-ethyl-2-fluoro-4-nitroaniline.
| Compound Name | N-[[(2S)-1,4-dibenzylpiperazin-2-yl]methyl]-N-ethyl-2-fluoro-4-nitroaniline |
|---|---|
| PubChem CID | 67274301 |
| Molecular Formula | C27H31FN4O2 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | N-[[(2S)-1,4-dibenzylpiperazin-2-yl]methyl]-N-ethyl-2-fluoro-4-nitroaniline |
| SMILES | CCN(C[C@@H]1CN(Cc2ccccc2)CCN1Cc1ccccc1)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C27H31FN4O2/c1-2-30(27-14-13-24(32(33)34)17-26(27)28)21-25-20-29(18-22-9-5-3-6-10-22)15-16-31(25)19-23-11-7-4-8-12-23/h3-14,17,25H,2,15-16,18-21H2,1H3/t25-/m0/s1 |
| InChIKey | QUFICQKCCBLMIH-VWLOTQADSA-N |
| XLogP | 4.95 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|