C10H8FNS — CID 67275565
4-(2-fluorophenyl)-5-methyl-1,3-thiazole (PubChem CID 67275565) has the molecular formula C10H8FNS and a molecular weight of 193.25 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-5-methyl-1,3-thiazole.
| Compound Name | 4-(2-fluorophenyl)-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 67275565 |
| Molecular Formula | C10H8FNS |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 4-(2-fluorophenyl)-5-methyl-1,3-thiazole |
| SMILES | Cc1scnc1-c1ccccc1F |
| InChI | InChI=1S/C10H8FNS/c1-7-10(12-6-13-7)8-4-2-3-5-9(8)11/h2-6H,1H3 |
| InChIKey | WXWFVPJQVYTSOZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |