C12H7FN2S — CID 156880797
5-(2-fluorophenyl)-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 156880797) has the molecular formula C12H7FN2S and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 5-(2-fluorophenyl)-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 156880797 |
| Molecular Formula | C12H7FN2S |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 5-(2-fluorophenyl)-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Fc1ccccc1-c1ccc2scnc2n1 |
| InChI | InChI=1S/C12H7FN2S/c13-9-4-2-1-3-8(9)10-5-6-11-12(15-10)14-7-16-11/h1-7H |
| InChIKey | XIQJCWDGRQHZGK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |