C22H28N2O4S — CID 67276420
(2R,3R)-3-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide (PubChem CID 67276420) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is (2R,3R)-3-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide.
| Compound Name | (2R,3R)-3-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide |
|---|---|
| PubChem CID | 67276420 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2R,3R)-3-methyl-2-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide |
| SMILES | C[C@@H]1CCCN1CCCOc1ccc([C@H]2Oc3cccnc3S(=O)(=O)[C@@H]2C)cc1 |
| InChI | InChI=1S/C22H28N2O4S/c1-16-6-4-13-24(16)14-5-15-27-19-10-8-18(9-11-19)21-17(2)29(25,26)22-20(28-21)7-3-12-23-22/h3,7-12,16-17,21H,4-6,13-15H2,1-2H3/t16-,17-,21+/m1/s1 |
| InChIKey | LDLXZORMKYNDJU-LZJOCLMNSA-N |
| XLogP | 3.63 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|