C22H28N2O4S — CID 143448865
(2S,3S)-2,3-dimethyl-2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-3H-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide (PubChem CID 143448865) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is (2S,3S)-2,3-dimethyl-2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-3H-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide.
| Compound Name | (2S,3S)-2,3-dimethyl-2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-3H-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide |
|---|---|
| PubChem CID | 143448865 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2S,3S)-2,3-dimethyl-2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-3H-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide |
| SMILES | C[C@H]1[C@](C)(c2ccc(OCCCN3CCCC3)cc2)Oc2cccnc2S1(=O)=O |
| InChI | InChI=1S/C22H28N2O4S/c1-17-22(2,28-20-7-5-12-23-21(20)29(17,25)26)18-8-10-19(11-9-18)27-16-6-15-24-13-3-4-14-24/h5,7-12,17H,3-4,6,13-16H2,1-2H3/t17-,22+/m0/s1 |
| InChIKey | IPWDLDLPUALULR-HTAPYJJXSA-N |
| XLogP | 3.42 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|