C21H26N2O4S — CID 69153042
3-methyl-8-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide (PubChem CID 69153042) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-methyl-8-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide.
| Compound Name | 3-methyl-8-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide |
|---|---|
| PubChem CID | 69153042 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3-methyl-8-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-2,3-dihydro-[1,4]oxathiino[3,2-b]pyridine 4,4-dioxide |
| SMILES | CC1COc2c(-c3ccc(OCCCN4CCCC4)cc3)ccnc2S1(=O)=O |
| InChI | InChI=1S/C21H26N2O4S/c1-16-15-27-20-19(9-10-22-21(20)28(16,24)25)17-5-7-18(8-6-17)26-14-4-13-23-11-2-3-12-23/h5-10,16H,2-4,11-15H2,1H3 |
| InChIKey | DMDGHTSTLMNDBM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|