C16H22FN5 — CID 67281260
5-[4-(dimethylamino)butyl]-2-N-(3-fluorophenyl)pyrimidine-2,4-diamine (PubChem CID 67281260) has the molecular formula C16H22FN5 and a molecular weight of 303.38 g/mol. Its IUPAC name is 5-[4-(dimethylamino)butyl]-2-N-(3-fluorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-[4-(dimethylamino)butyl]-2-N-(3-fluorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67281260 |
| Molecular Formula | C16H22FN5 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 5-[4-(dimethylamino)butyl]-2-N-(3-fluorophenyl)pyrimidine-2,4-diamine |
| SMILES | CN(C)CCCCc1cnc(Nc2cccc(F)c2)nc1N |
| InChI | InChI=1S/C16H22FN5/c1-22(2)9-4-3-6-12-11-19-16(21-15(12)18)20-14-8-5-7-13(17)10-14/h5,7-8,10-11H,3-4,6,9H2,1-2H3,(H3,18,19,20,21) |
| InChIKey | WMBCDWDJBYEVAQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|