C27H24N2O8 — CID 67281516
10-[(3-cyanoanilino)methyl]-4-(ethoxymethyl)-3,9-dihydroxy-1,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylic acid (PubChem CID 67281516) has the molecular formula C27H24N2O8 and a molecular weight of 504.50 g/mol. Its IUPAC name is 10-[(3-cyanoanilino)methyl]-4-(ethoxymethyl)-3,9-dihydroxy-1,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylic acid.
| Compound Name | 10-[(3-cyanoanilino)methyl]-4-(ethoxymethyl)-3,9-dihydroxy-1,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylic acid |
|---|---|
| PubChem CID | 67281516 |
| Molecular Formula | C27H24N2O8 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 10-[(3-cyanoanilino)methyl]-4-(ethoxymethyl)-3,9-dihydroxy-1,7-dimethyl-6-oxobenzo[b][1,4]benzodioxepine-2-carboxylic acid |
| SMILES | CCOCc1c(O)c(C(=O)O)c(C)c2c1OC(=O)c1c(C)cc(O)c(CNc3cccc(C#N)c3)c1O2 |
| InChI | InChI=1S/C27H24N2O8/c1-4-35-12-18-22(31)21(26(32)33)14(3)23-25(18)37-27(34)20-13(2)8-19(30)17(24(20)36-23)11-29-16-7-5-6-15(9-16)10-28/h5-9,29-31H,4,11-12H2,1-3H3,(H,32,33) |
| InChIKey | JCERJTXJIDGYDZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 158.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|