C15H23N3O6 — CID 67283408
8-O-tert-butyl 6-O-ethyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-6,8-dicarboxylate (PubChem CID 67283408) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is 8-O-tert-butyl 6-O-ethyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-6,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 6-O-ethyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-6,8-dicarboxylate |
|---|---|
| PubChem CID | 67283408 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 8-O-tert-butyl 6-O-ethyl 2,4-dioxo-1,3,8-triazaspiro[4.5]decane-6,8-dicarboxylate |
| SMILES | CCOC(=O)C1CN(C(=O)OC(C)(C)C)CCC12NC(=O)NC2=O |
| InChI | InChI=1S/C15H23N3O6/c1-5-23-10(19)9-8-18(13(22)24-14(2,3)4)7-6-15(9)11(20)16-12(21)17-15/h9H,5-8H2,1-4H3,(H2,16,17,20,21) |
| InChIKey | SHPKVJZCWIDYLV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|