C13H22N2O4 — CID 20833915
ethyl 2-(4-methyl-2,5-dioxo-1-propylimidazolidin-4-yl)butanoate (PubChem CID 20833915) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is ethyl 2-(4-methyl-2,5-dioxo-1-propylimidazolidin-4-yl)butanoate.
| Compound Name | ethyl 2-(4-methyl-2,5-dioxo-1-propylimidazolidin-4-yl)butanoate |
|---|---|
| PubChem CID | 20833915 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | ethyl 2-(4-methyl-2,5-dioxo-1-propylimidazolidin-4-yl)butanoate |
| SMILES | CCCN1C(=O)NC(C)(C(CC)C(=O)OCC)C1=O |
| InChI | InChI=1S/C13H22N2O4/c1-5-8-15-11(17)13(4,14-12(15)18)9(6-2)10(16)19-7-3/h9H,5-8H2,1-4H3,(H,14,18) |
| InChIKey | XYZXCOILYXXUMM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|