C10H16N2O4 — CID 20833914
ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)butanoate (PubChem CID 20833914) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)butanoate.
| Compound Name | ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)butanoate |
|---|---|
| PubChem CID | 20833914 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | ethyl 2-(4-methyl-2,5-dioxoimidazolidin-4-yl)butanoate |
| SMILES | CCOC(=O)C(CC)C1(C)NC(=O)NC1=O |
| InChI | InChI=1S/C10H16N2O4/c1-4-6(7(13)16-5-2)10(3)8(14)11-9(15)12-10/h6H,4-5H2,1-3H3,(H2,11,12,14,15) |
| InChIKey | FNEUAYRVIVPOCC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|