About ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate
ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate (PubChem CID 20833905) has the molecular formula C13H20N2O5
and a molecular weight of 284.31 g/mol. Its IUPAC name is ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate |
| PubChem CID | 20833905 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate |
| SMILES | CCOC(=O)C(CC)C1(C)NC(=O)N(CC(C)=O)C1=O |
| InChI | InChI=1S/C13H20N2O5/c1-5-9(10(17)20-6-2)13(4)11(18)15(7-8(3)16)12(19)14-13/h9H,5-7H2,1-4H3,(H,14,19) |
| InChIKey | SXEIWNONWWAXIC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate?
The IUPAC name of ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate (CID 20833905) is ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate.
What is the SMILES notation for ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate?
The canonical SMILES for ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate is CCOC(=O)C(CC)C1(C)NC(=O)N(CC(C)=O)C1=O.
What is the InChIKey of ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate?
The InChIKey is SXEIWNONWWAXIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O5/c1-5-9(10(17)20-6-2)13(4)11(18)15(7-8(3)16)12(19)14-13/h9H,5-7H2,1-4H3,(H,14,19).
What are the key properties of ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate?
ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate has a molecular weight of 284.31 g/mol, XLogP of 0.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-methyl-2,5-dioxo-1-(2-oxopropyl)imidazolidin-4-yl]butanoate is sourced from PubChem (CID 20833905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).