C13H19F3N2O4 — CID 162594511
pentan-2-yl 2-[4-methyl-2,5-dioxo-1-(2,2,2-trifluoroethyl)imidazolidin-4-yl]acetate (PubChem CID 162594511) has the molecular formula C13H19F3N2O4 and a molecular weight of 324.30 g/mol. Its IUPAC name is pentan-2-yl 2-[4-methyl-2,5-dioxo-1-(2,2,2-trifluoroethyl)imidazolidin-4-yl]acetate.
| Compound Name | pentan-2-yl 2-[4-methyl-2,5-dioxo-1-(2,2,2-trifluoroethyl)imidazolidin-4-yl]acetate |
|---|---|
| PubChem CID | 162594511 |
| Molecular Formula | C13H19F3N2O4 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | pentan-2-yl 2-[4-methyl-2,5-dioxo-1-(2,2,2-trifluoroethyl)imidazolidin-4-yl]acetate |
| SMILES | CCCC(C)OC(=O)CC1(C)NC(=O)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C13H19F3N2O4/c1-4-5-8(2)22-9(19)6-12(3)10(20)18(11(21)17-12)7-13(14,15)16/h8H,4-7H2,1-3H3,(H,17,21) |
| InChIKey | JWDWBNAUNZSYMS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|