C16H25F3N2O4 — CID 11314570
ethyl (2S)-2-[(4S)-1,3-ditert-butyl-2,5-dioxoimidazolidin-4-yl]-3,3,3-trifluoropropanoate (PubChem CID 11314570) has the molecular formula C16H25F3N2O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is ethyl (2S)-2-[(4S)-1,3-ditert-butyl-2,5-dioxoimidazolidin-4-yl]-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2S)-2-[(4S)-1,3-ditert-butyl-2,5-dioxoimidazolidin-4-yl]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 11314570 |
| Molecular Formula | C16H25F3N2O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethyl (2S)-2-[(4S)-1,3-ditert-butyl-2,5-dioxoimidazolidin-4-yl]-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)[C@H]([C@H]1C(=O)N(C(C)(C)C)C(=O)N1C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H25F3N2O4/c1-8-25-12(23)9(16(17,18)19)10-11(22)21(15(5,6)7)13(24)20(10)14(2,3)4/h9-10H,8H2,1-7H3/t9-,10-/m0/s1 |
| InChIKey | DVOYCEJJCPZVIJ-UWVGGRQHSA-N |
| XLogP | 2.96 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|