C12H20N2O5 — CID 20833913
ethyl 2-[1-(2-hydroxyethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]butanoate (PubChem CID 20833913) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is ethyl 2-[1-(2-hydroxyethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]butanoate.
| Compound Name | ethyl 2-[1-(2-hydroxyethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]butanoate |
|---|---|
| PubChem CID | 20833913 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | ethyl 2-[1-(2-hydroxyethyl)-4-methyl-2,5-dioxoimidazolidin-4-yl]butanoate |
| SMILES | CCOC(=O)C(CC)C1(C)NC(=O)N(CCO)C1=O |
| InChI | InChI=1S/C12H20N2O5/c1-4-8(9(16)19-5-2)12(3)10(17)14(6-7-15)11(18)13-12/h8,15H,4-7H2,1-3H3,(H,13,18) |
| InChIKey | LLRYNEFKGQVENC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|