About 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid
2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid (PubChem CID 118355128) has the molecular formula C13H22N4O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid |
| PubChem CID | 118355128 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid |
| SMILES | CCC(C(=O)O)C1(C)NC(=O)N(CN2CCNCC2)C1=O |
| InChI | InChI=1S/C13H22N4O4/c1-3-9(10(18)19)13(2)11(20)17(12(21)15-13)8-16-6-4-14-5-7-16/h9,14H,3-8H2,1-2H3,(H,15,21)(H,18,19) |
| InChIKey | WMWBVMNKUNFBMW-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid?
The IUPAC name of 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid (CID 118355128) is 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid.
What is the SMILES notation for 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid?
The canonical SMILES for 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid is CCC(C(=O)O)C1(C)NC(=O)N(CN2CCNCC2)C1=O.
What is the InChIKey of 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid?
The InChIKey is WMWBVMNKUNFBMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4O4/c1-3-9(10(18)19)13(2)11(20)17(12(21)15-13)8-16-6-4-14-5-7-16/h9,14H,3-8H2,1-2H3,(H,15,21)(H,18,19).
What are the key properties of 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid?
2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid has a molecular weight of 298.34 g/mol, XLogP of -0.73, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methyl-2,5-dioxo-1-(piperazin-1-ylmethyl)imidazolidin-4-yl]butanoic acid is sourced from PubChem (CID 118355128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).