C21H26ClF3NO4PS — CID 67287351
[(3S)-3-amino-3-[2-[2-chloro-4-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfanylphenyl]ethyl]hexyl]phosphonic acid (PubChem CID 67287351) has the molecular formula C21H26ClF3NO4PS and a molecular weight of 511.93 g/mol. Its IUPAC name is [(3S)-3-amino-3-[2-[2-chloro-4-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfanylphenyl]ethyl]hexyl]phosphonic acid.
| Compound Name | [(3S)-3-amino-3-[2-[2-chloro-4-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfanylphenyl]ethyl]hexyl]phosphonic acid |
|---|---|
| PubChem CID | 67287351 |
| Molecular Formula | C21H26ClF3NO4PS |
| Molecular Weight | 511.93 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | [(3S)-3-amino-3-[2-[2-chloro-4-[2-hydroxy-5-(trifluoromethyl)phenyl]sulfanylphenyl]ethyl]hexyl]phosphonic acid |
| SMILES | CCC[C@](N)(CCc1ccc(Sc2cc(C(F)(F)F)ccc2O)cc1Cl)CCP(=O)(O)O |
| InChI | InChI=1S/C21H26ClF3NO4PS/c1-2-8-20(26,10-11-31(28,29)30)9-7-14-3-5-16(13-17(14)22)32-19-12-15(21(23,24)25)4-6-18(19)27/h3-6,12-13,27H,2,7-11,26H2,1H3,(H2,28,29,30)/t20-/m0/s1 |
| InChIKey | ZOERVRIYPSJUOH-FQEVSTJZSA-N |
| XLogP | 6.21 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.93 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|