C18H22Cl2NO3PS — CID 69035628
[(2R)-2-amino-5-[2-chloro-4-(3-chlorophenyl)sulfanylphenyl]-2-methylpentyl]phosphonic acid (PubChem CID 69035628) has the molecular formula C18H22Cl2NO3PS and a molecular weight of 434.33 g/mol. Its IUPAC name is [(2R)-2-amino-5-[2-chloro-4-(3-chlorophenyl)sulfanylphenyl]-2-methylpentyl]phosphonic acid.
| Compound Name | [(2R)-2-amino-5-[2-chloro-4-(3-chlorophenyl)sulfanylphenyl]-2-methylpentyl]phosphonic acid |
|---|---|
| PubChem CID | 69035628 |
| Molecular Formula | C18H22Cl2NO3PS |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | [(2R)-2-amino-5-[2-chloro-4-(3-chlorophenyl)sulfanylphenyl]-2-methylpentyl]phosphonic acid |
| SMILES | C[C@@](N)(CCCc1ccc(Sc2cccc(Cl)c2)cc1Cl)CP(=O)(O)O |
| InChI | InChI=1S/C18H22Cl2NO3PS/c1-18(21,12-25(22,23)24)9-3-4-13-7-8-16(11-17(13)20)26-15-6-2-5-14(19)10-15/h2,5-8,10-11H,3-4,9,12,21H2,1H3,(H2,22,23,24)/t18-/m1/s1 |
| InChIKey | NHCVHLGPXAASBR-GOSISDBHSA-N |
| XLogP | 5.36 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|