C19H23ClF2NO3PS — CID 69006579
[(2R)-2-amino-5-[2-chloro-4-[3-(difluoromethyl)phenyl]sulfanylphenyl]-2-methylpentyl]phosphonic acid (PubChem CID 69006579) has the molecular formula C19H23ClF2NO3PS and a molecular weight of 449.89 g/mol. Its IUPAC name is [(2R)-2-amino-5-[2-chloro-4-[3-(difluoromethyl)phenyl]sulfanylphenyl]-2-methylpentyl]phosphonic acid.
| Compound Name | [(2R)-2-amino-5-[2-chloro-4-[3-(difluoromethyl)phenyl]sulfanylphenyl]-2-methylpentyl]phosphonic acid |
|---|---|
| PubChem CID | 69006579 |
| Molecular Formula | C19H23ClF2NO3PS |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | [(2R)-2-amino-5-[2-chloro-4-[3-(difluoromethyl)phenyl]sulfanylphenyl]-2-methylpentyl]phosphonic acid |
| SMILES | C[C@@](N)(CCCc1ccc(Sc2cccc(C(F)F)c2)cc1Cl)CP(=O)(O)O |
| InChI | InChI=1S/C19H23ClF2NO3PS/c1-19(23,12-27(24,25)26)9-3-5-13-7-8-16(11-17(13)20)28-15-6-2-4-14(10-15)18(21)22/h2,4,6-8,10-11,18H,3,5,9,12,23H2,1H3,(H2,24,25,26)/t19-/m1/s1 |
| InChIKey | RNUDWASWNYUWBU-LJQANCHMSA-N |
| XLogP | 5.65 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|