C56H60N4 — CID 67290137
9,9-bis(2-ethylhexyl)-N,N-diphenyl-7-[2-(6-pyridin-2-yl-2-pyridinyl)-4-pyridinyl]fluoren-2-amine (PubChem CID 67290137) has the molecular formula C56H60N4 and a molecular weight of 789.12 g/mol. Its IUPAC name is 9,9-bis(2-ethylhexyl)-N,N-diphenyl-7-[2-(6-pyridin-2-yl-2-pyridinyl)-4-pyridinyl]fluoren-2-amine.
| Compound Name | 9,9-bis(2-ethylhexyl)-N,N-diphenyl-7-[2-(6-pyridin-2-yl-2-pyridinyl)-4-pyridinyl]fluoren-2-amine |
|---|---|
| PubChem CID | 67290137 |
| Molecular Formula | C56H60N4 |
| Molecular Weight | 789.12 g/mol |
| Exact Mass | 788.48 |
| IUPAC Name | 9,9-bis(2-ethylhexyl)-N,N-diphenyl-7-[2-(6-pyridin-2-yl-2-pyridinyl)-4-pyridinyl]fluoren-2-amine |
| SMILES | CCCCC(CC)CC1(CC(CC)CCCC)c2cc(-c3ccnc(-c4cccc(-c5ccccn5)n4)c3)ccc2-c2ccc(N(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C56H60N4/c1-5-9-20-41(7-3)39-56(40-42(8-4)21-10-6-2)50-36-43(44-33-35-58-55(37-44)54-28-19-27-53(59-54)52-26-17-18-34-57-52)29-31-48(50)49-32-30-47(38-51(49)56)60(45-22-13-11-14-23-45)46-24-15-12-16-25-46/h11-19,22-38,41-42H,5-10,20-21,39-40H2,1-4H3 |
| InChIKey | VXUSUNIFMWGEFO-UHFFFAOYSA-N |
| XLogP | 15.82 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.12 |
| LogP ≤ 5 | 15.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |