C38H28N6 — CID 162652616
4-[4-[4-(9,9-dimethylfluoren-2-yl)triazol-1-yl]phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 162652616) has the molecular formula C38H28N6 and a molecular weight of 568.68 g/mol. Its IUPAC name is 4-[4-[4-(9,9-dimethylfluoren-2-yl)triazol-1-yl]phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-[4-(9,9-dimethylfluoren-2-yl)triazol-1-yl]phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 162652616 |
| Molecular Formula | C38H28N6 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 4-[4-[4-(9,9-dimethylfluoren-2-yl)triazol-1-yl]phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cn(-c4ccc(-c5cc(-c6ccccn6)nc(-c6ccccn6)c5)cc4)nn3)cc21 |
| InChI | InChI=1S/C38H28N6/c1-38(2)31-10-4-3-9-29(31)30-18-15-26(21-32(30)38)37-24-44(43-42-37)28-16-13-25(14-17-28)27-22-35(33-11-5-7-19-39-33)41-36(23-27)34-12-6-8-20-40-34/h3-24H,1-2H3 |
| InChIKey | QYVXAVHHMQYWHM-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |