C14H21N3O6 — CID 67290709
[8-hydroxy-5-(2,4,6-trioxo-1,3,5-triazinan-1-yl)octan-3-yl] prop-2-enoate (PubChem CID 67290709) has the molecular formula C14H21N3O6 and a molecular weight of 327.34 g/mol. Its IUPAC name is [8-hydroxy-5-(2,4,6-trioxo-1,3,5-triazinan-1-yl)octan-3-yl] prop-2-enoate.
| Compound Name | [8-hydroxy-5-(2,4,6-trioxo-1,3,5-triazinan-1-yl)octan-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 67290709 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | [8-hydroxy-5-(2,4,6-trioxo-1,3,5-triazinan-1-yl)octan-3-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)CC(CCCO)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H21N3O6/c1-3-10(23-11(19)4-2)8-9(6-5-7-18)17-13(21)15-12(20)16-14(17)22/h4,9-10,18H,2-3,5-8H2,1H3,(H2,15,16,20,21,22) |
| InChIKey | SGCRGQILTZWFOY-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|