C21H22F3N3O2 — CID 67290823
4-(1H-indol-3-yl)-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]butanamide (PubChem CID 67290823) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]butanamide |
|---|---|
| PubChem CID | 67290823 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]butanamide |
| SMILES | CC(NC(=O)CCCc1c[nH]c2ccccc12)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C21H22F3N3O2/c1-14(18-10-9-16(12-26-18)29-13-21(22,23)24)27-20(28)8-4-5-15-11-25-19-7-3-2-6-17(15)19/h2-3,6-7,9-12,14,25H,4-5,8,13H2,1H3,(H,27,28) |
| InChIKey | HSZGMDYIJMEJKT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |