C20H18F3N3O2 — CID 67290430
(E)-3-(1H-indol-3-yl)-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]prop-2-enamide (PubChem CID 67290430) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is (E)-3-(1H-indol-3-yl)-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1H-indol-3-yl)-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 67290430 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (E)-3-(1H-indol-3-yl)-N-[1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1c[nH]c2ccccc12)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C20H18F3N3O2/c1-13(17-8-7-15(11-25-17)28-12-20(21,22)23)26-19(27)9-6-14-10-24-18-5-3-2-4-16(14)18/h2-11,13,24H,12H2,1H3,(H,26,27)/b9-6+ |
| InChIKey | GPIQBNSDTIDFDU-RMKNXTFCSA-N |
| XLogP | 4.39 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|