C21H18F3N3O2 — CID 67291373
3-quinolin-2-yl-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]prop-2-enamide (PubChem CID 67291373) has the molecular formula C21H18F3N3O2 and a molecular weight of 401.39 g/mol. Its IUPAC name is 3-quinolin-2-yl-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]prop-2-enamide.
| Compound Name | 3-quinolin-2-yl-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 67291373 |
| Molecular Formula | C21H18F3N3O2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-quinolin-2-yl-N-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)C=Cc1ccc2ccccc2n1)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C21H18F3N3O2/c1-14(18-10-9-17(12-25-18)29-13-21(22,23)24)26-20(28)11-8-16-7-6-15-4-2-3-5-19(15)27-16/h2-12,14H,13H2,1H3,(H,26,28)/t14-/m1/s1 |
| InChIKey | DHUAWPVYYLIHQJ-CQSZACIVSA-N |
| XLogP | 4.46 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|