C11H18N4 — CID 67293147
3-(2-pyrrolidin-1-ylethyl)pyridine-2,4-diamine (PubChem CID 67293147) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-(2-pyrrolidin-1-ylethyl)pyridine-2,4-diamine.
| Compound Name | 3-(2-pyrrolidin-1-ylethyl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 67293147 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 3-(2-pyrrolidin-1-ylethyl)pyridine-2,4-diamine |
| SMILES | Nc1ccnc(N)c1CCN1CCCC1 |
| InChI | InChI=1S/C11H18N4/c12-10-3-5-14-11(13)9(10)4-8-15-6-1-2-7-15/h3,5H,1-2,4,6-8H2,(H4,12,13,14) |
| InChIKey | WJTAHHFKMDJIFP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |