C16H31O4P — CID 67295920
[2-(1,2-dimethylcyclohexyl)-1-ethylcyclohexyl] dihydrogen phosphate (PubChem CID 67295920) has the molecular formula C16H31O4P and a molecular weight of 318.39 g/mol. Its IUPAC name is [2-(1,2-dimethylcyclohexyl)-1-ethylcyclohexyl] dihydrogen phosphate.
| Compound Name | [2-(1,2-dimethylcyclohexyl)-1-ethylcyclohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 67295920 |
| Molecular Formula | C16H31O4P |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | [2-(1,2-dimethylcyclohexyl)-1-ethylcyclohexyl] dihydrogen phosphate |
| SMILES | CCC1(OP(=O)(O)O)CCCCC1C1(C)CCCCC1C |
| InChI | InChI=1S/C16H31O4P/c1-4-16(20-21(17,18)19)12-8-6-10-14(16)15(3)11-7-5-9-13(15)2/h13-14H,4-12H2,1-3H3,(H2,17,18,19) |
| InChIKey | VQMFTTRHJGUOCK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|