C28H32Cl2FN3O3 — CID 67296959
(3-amino-2,2-dimethyl-3-oxopropyl) (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate (PubChem CID 67296959) has the molecular formula C28H32Cl2FN3O3 and a molecular weight of 548.49 g/mol. Its IUPAC name is (3-amino-2,2-dimethyl-3-oxopropyl) (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate.
| Compound Name | (3-amino-2,2-dimethyl-3-oxopropyl) (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 67296959 |
| Molecular Formula | C28H32Cl2FN3O3 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | (3-amino-2,2-dimethyl-3-oxopropyl) (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)OCC(C)(C)C(N)=O)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H32Cl2FN3O3/c1-26(2,3)13-20-28(14-32,16-9-11-17(29)12-10-16)21(18-7-6-8-19(30)22(18)31)23(34-20)24(35)37-15-27(4,5)25(33)36/h6-12,20-21,23,34H,13,15H2,1-5H3,(H2,33,36)/t20-,21-,23+,28-/m0/s1 |
| InChIKey | FHCSOOFUKSEVJV-XFUJDDPRSA-N |
| XLogP | 5.51 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |