C27H30Cl2FN3O2 — CID 59249339
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-N-(cyclopropylmethoxy)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide (PubChem CID 59249339) has the molecular formula C27H30Cl2FN3O2 and a molecular weight of 518.46 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-N-(cyclopropylmethoxy)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-N-(cyclopropylmethoxy)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59249339 |
| Molecular Formula | C27H30Cl2FN3O2 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-N-(cyclopropylmethoxy)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)NOCC2CC2)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H30Cl2FN3O2/c1-26(2,3)13-21-27(15-31,17-9-11-18(28)12-10-17)22(19-5-4-6-20(29)23(19)30)24(32-21)25(34)33-35-14-16-7-8-16/h4-6,9-12,16,21-22,24,32H,7-8,13-14H2,1-3H3,(H,33,34)/t21-,22-,24+,27-/m0/s1 |
| InChIKey | RZPVLRWUVLYHSZ-VSBUBRIKSA-N |
| XLogP | 5.91 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|