C29H32Cl2FN5O — CID 45137580
(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(3-imidazol-1-ylpropyl)pyrrolidine-2-carboxamide (PubChem CID 45137580) has the molecular formula C29H32Cl2FN5O and a molecular weight of 556.51 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(3-imidazol-1-ylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(3-imidazol-1-ylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45137580 |
| Molecular Formula | C29H32Cl2FN5O |
| Molecular Weight | 556.51 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | (2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(3-imidazol-1-ylpropyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)NCCCn2ccnc2)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H32Cl2FN5O/c1-28(2,3)16-23-29(17-33,19-8-10-20(30)11-9-19)24(21-6-4-7-22(31)25(21)32)26(36-23)27(38)35-12-5-14-37-15-13-34-18-37/h4,6-11,13,15,18,23-24,26,36H,5,12,14,16H2,1-3H3,(H,35,38)/t23-,24-,26+,29-/m0/s1 |
| InChIKey | ARODCSQRNCBKIF-PDRJRCDBSA-N |
| XLogP | 5.86 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|