C20H15N2O4S2- — CID 67299037
2-carboxy-5-[(3-cyanophenyl)methyl]-3-(2-methyl-N-sulfinatoanilino)thiophene (PubChem CID 67299037) has the molecular formula C20H15N2O4S2- and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-carboxy-5-[(3-cyanophenyl)methyl]-3-(2-methyl-N-sulfinatoanilino)thiophene.
| Compound Name | 2-carboxy-5-[(3-cyanophenyl)methyl]-3-(2-methyl-N-sulfinatoanilino)thiophene |
|---|---|
| PubChem CID | 67299037 |
| Molecular Formula | C20H15N2O4S2- |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-carboxy-5-[(3-cyanophenyl)methyl]-3-(2-methyl-N-sulfinatoanilino)thiophene |
| SMILES | Cc1ccccc1N(c1cc(Cc2cccc(C#N)c2)sc1C(=O)O)S(=O)[O-] |
| InChI | InChI=1S/C20H16N2O4S2/c1-13-5-2-3-8-17(13)22(28(25)26)18-11-16(27-19(18)20(23)24)10-14-6-4-7-15(9-14)12-21/h2-9,11H,10H2,1H3,(H,23,24)(H,25,26)/p-1 |
| InChIKey | MSQPYCKYHKDFJW-UHFFFAOYSA-M |
| XLogP | 4.15 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|