C18H14N2O6S2 — CID 67298970
3-(2-methyl-N-sulfinoanilino)-5-(4-nitrophenyl)thiophene-2-carboxylic acid (PubChem CID 67298970) has the molecular formula C18H14N2O6S2 and a molecular weight of 418.45 g/mol. Its IUPAC name is 3-(2-methyl-N-sulfinoanilino)-5-(4-nitrophenyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(2-methyl-N-sulfinoanilino)-5-(4-nitrophenyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67298970 |
| Molecular Formula | C18H14N2O6S2 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 3-(2-methyl-N-sulfinoanilino)-5-(4-nitrophenyl)thiophene-2-carboxylic acid |
| SMILES | Cc1ccccc1N(c1cc(-c2ccc([N+](=O)[O-])cc2)sc1C(=O)O)S(=O)O |
| InChI | InChI=1S/C18H14N2O6S2/c1-11-4-2-3-5-14(11)19(28(25)26)15-10-16(27-17(15)18(21)22)12-6-8-13(9-7-12)20(23)24/h2-10H,1H3,(H,21,22)(H,25,26) |
| InChIKey | VOXPWQARAVFCKE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|