C18H14FNO4S2 — CID 67415776
5-(4-fluorophenyl)-3-(3-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid (PubChem CID 67415776) has the molecular formula C18H14FNO4S2 and a molecular weight of 391.45 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-(3-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-fluorophenyl)-3-(3-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67415776 |
| Molecular Formula | C18H14FNO4S2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 5-(4-fluorophenyl)-3-(3-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid |
| SMILES | Cc1cccc(N(c2cc(-c3ccc(F)cc3)sc2C(=O)O)S(=O)O)c1 |
| InChI | InChI=1S/C18H14FNO4S2/c1-11-3-2-4-14(9-11)20(26(23)24)15-10-16(25-17(15)18(21)22)12-5-7-13(19)8-6-12/h2-10H,1H3,(H,21,22)(H,23,24) |
| InChIKey | BGNZGLNVLSEBRO-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|