C19H15NO6S2 — CID 67298985
5-(4-carboxyphenyl)-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid (PubChem CID 67298985) has the molecular formula C19H15NO6S2 and a molecular weight of 417.46 g/mol. Its IUPAC name is 5-(4-carboxyphenyl)-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid.
| Compound Name | 5-(4-carboxyphenyl)-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67298985 |
| Molecular Formula | C19H15NO6S2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 5-(4-carboxyphenyl)-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid |
| SMILES | Cc1ccccc1N(c1cc(-c2ccc(C(=O)O)cc2)sc1C(=O)O)S(=O)O |
| InChI | InChI=1S/C19H15NO6S2/c1-11-4-2-3-5-14(11)20(28(25)26)15-10-16(27-17(15)19(23)24)12-6-8-13(9-7-12)18(21)22/h2-10H,1H3,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | HPMWCDUJFADTAD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|