C18H13Cl2NO4S2 — CID 67415112
5-(2,5-dichlorophenyl)-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid (PubChem CID 67415112) has the molecular formula C18H13Cl2NO4S2 and a molecular weight of 442.35 g/mol. Its IUPAC name is 5-(2,5-dichlorophenyl)-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid.
| Compound Name | 5-(2,5-dichlorophenyl)-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67415112 |
| Molecular Formula | C18H13Cl2NO4S2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 440.97 |
| IUPAC Name | 5-(2,5-dichlorophenyl)-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid |
| SMILES | Cc1ccccc1N(c1cc(-c2cc(Cl)ccc2Cl)sc1C(=O)O)S(=O)O |
| InChI | InChI=1S/C18H13Cl2NO4S2/c1-10-4-2-3-5-14(10)21(27(24)25)15-9-16(26-17(15)18(22)23)12-8-11(19)6-7-13(12)20/h2-9H,1H3,(H,22,23)(H,24,25) |
| InChIKey | KSVHFJBCPYOTKJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|