C18H15N2O4S2- — CID 67298972
5-(3-aminophenyl)-2-carboxy-3-(2-methyl-N-sulfinatoanilino)thiophene (PubChem CID 67298972) has the molecular formula C18H15N2O4S2- and a molecular weight of 387.46 g/mol. Its IUPAC name is 5-(3-aminophenyl)-2-carboxy-3-(2-methyl-N-sulfinatoanilino)thiophene.
| Compound Name | 5-(3-aminophenyl)-2-carboxy-3-(2-methyl-N-sulfinatoanilino)thiophene |
|---|---|
| PubChem CID | 67298972 |
| Molecular Formula | C18H15N2O4S2- |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 5-(3-aminophenyl)-2-carboxy-3-(2-methyl-N-sulfinatoanilino)thiophene |
| SMILES | Cc1ccccc1N(c1cc(-c2cccc(N)c2)sc1C(=O)O)S(=O)[O-] |
| InChI | InChI=1S/C18H16N2O4S2/c1-11-5-2-3-8-14(11)20(26(23)24)15-10-16(25-17(15)18(21)22)12-6-4-7-13(19)9-12/h2-10H,19H2,1H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | GCECXCAGZIOAEL-UHFFFAOYSA-M |
| XLogP | 3.94 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|