C19H18N2O6S3 — CID 67298982
5-[4-(methanesulfonamido)phenyl]-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid (PubChem CID 67298982) has the molecular formula C19H18N2O6S3 and a molecular weight of 466.56 g/mol. Its IUPAC name is 5-[4-(methanesulfonamido)phenyl]-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid.
| Compound Name | 5-[4-(methanesulfonamido)phenyl]-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 67298982 |
| Molecular Formula | C19H18N2O6S3 |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | 5-[4-(methanesulfonamido)phenyl]-3-(2-methyl-N-sulfinoanilino)thiophene-2-carboxylic acid |
| SMILES | Cc1ccccc1N(c1cc(-c2ccc(NS(C)(=O)=O)cc2)sc1C(=O)O)S(=O)O |
| InChI | InChI=1S/C19H18N2O6S3/c1-12-5-3-4-6-15(12)21(29(24)25)16-11-17(28-18(16)19(22)23)13-7-9-14(10-8-13)20-30(2,26)27/h3-11,20H,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | CYMQUGXNNINXPE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|