C24H26F3N6O4+ — CID 67299208
[2-[5-[4-(cyclohexylcarbamoyl)piperazin-1-yl]-1,2,4-oxadiazol-3-yl]quinolin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 67299208) has the molecular formula C24H26F3N6O4+ and a molecular weight of 519.50 g/mol. Its IUPAC name is [2-[5-[4-(cyclohexylcarbamoyl)piperazin-1-yl]-1,2,4-oxadiazol-3-yl]quinolin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[5-[4-(cyclohexylcarbamoyl)piperazin-1-yl]-1,2,4-oxadiazol-3-yl]quinolin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67299208 |
| Molecular Formula | C24H26F3N6O4+ |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [2-[5-[4-(cyclohexylcarbamoyl)piperazin-1-yl]-1,2,4-oxadiazol-3-yl]quinolin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(NC1CCCCC1)N1CCN(c2nc(-c3ccc4ccccc4[n+]3OC(=O)C(F)(F)F)no2)CC1 |
| InChI | InChI=1S/C24H25F3N6O4/c25-24(26,27)21(34)37-33-18-9-5-4-6-16(18)10-11-19(33)20-29-23(36-30-20)32-14-12-31(13-15-32)22(35)28-17-7-2-1-3-8-17/h4-6,9-11,17H,1-3,7-8,12-15H2/p+1 |
| InChIKey | RLNBGWZZTFHHTE-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|