C15H21ClN2O — CID 67300022
1-(2-benzyl-3-prop-2-enyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol chloride (PubChem CID 67300022) has the molecular formula C15H21ClN2O and a molecular weight of 280.80 g/mol. Its IUPAC name is 1-(2-benzyl-3-prop-2-enyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol chloride.
| Compound Name | 1-(2-benzyl-3-prop-2-enyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol chloride |
|---|---|
| PubChem CID | 67300022 |
| Molecular Formula | C15H21ClN2O |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(2-benzyl-3-prop-2-enyl-4,5-dihydroimidazol-3-ium-1-yl)ethanol chloride |
| SMILES | C=CC[N+]1=C(Cc2ccccc2)N(C(C)O)CC1.[Cl-] |
| InChI | InChI=1S/C15H21N2O.ClH/c1-3-9-16-10-11-17(13(2)18)15(16)12-14-7-5-4-6-8-14;/h3-8,13,18H,1,9-12H2,2H3;1H/q+1;/p-1 |
| InChIKey | RGZMUFARIJWDBA-UHFFFAOYSA-M |
| XLogP | -1.52 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|