C25H29ClN2O4 — CID 67300060
methyl 1-(2-benzamido-3-methylbutanoyl)-4-(4-chlorophenyl)piperidine-4-carboxylate (PubChem CID 67300060) has the molecular formula C25H29ClN2O4 and a molecular weight of 456.97 g/mol. Its IUPAC name is methyl 1-(2-benzamido-3-methylbutanoyl)-4-(4-chlorophenyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(2-benzamido-3-methylbutanoyl)-4-(4-chlorophenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 67300060 |
| Molecular Formula | C25H29ClN2O4 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | methyl 1-(2-benzamido-3-methylbutanoyl)-4-(4-chlorophenyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1(c2ccc(Cl)cc2)CCN(C(=O)C(NC(=O)c2ccccc2)C(C)C)CC1 |
| InChI | InChI=1S/C25H29ClN2O4/c1-17(2)21(27-22(29)18-7-5-4-6-8-18)23(30)28-15-13-25(14-16-28,24(31)32-3)19-9-11-20(26)12-10-19/h4-12,17,21H,13-16H2,1-3H3,(H,27,29) |
| InChIKey | OQEGOHRNOYJZGE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |