C24H27ClN2O3 — CID 89146016
N-[(2R)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3-methylidenepiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 89146016) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is N-[(2R)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3-methylidenepiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | N-[(2R)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3-methylidenepiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 89146016 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | N-[(2R)-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3-methylidenepiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | C=C1CN(C(=O)[C@H](NC(=O)c2ccccc2)C(C)C)CC[C@]1(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H27ClN2O3/c1-16(2)21(26-22(28)18-7-5-4-6-8-18)23(29)27-14-13-24(30,17(3)15-27)19-9-11-20(25)12-10-19/h4-12,16,21,30H,3,13-15H2,1-2H3,(H,26,28)/t21-,24-/m1/s1 |
| InChIKey | SRZZDZQSGUXYGR-ZJSXRUAMSA-N |
| XLogP | 3.77 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|