C17H23ClN2O2 — CID 89146017
(2R)-2-amino-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3-methylidenepiperidin-1-yl]-3-methylbutan-1-one (PubChem CID 89146017) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is (2R)-2-amino-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3-methylidenepiperidin-1-yl]-3-methylbutan-1-one.
| Compound Name | (2R)-2-amino-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3-methylidenepiperidin-1-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 89146017 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (2R)-2-amino-1-[(4S)-4-(4-chlorophenyl)-4-hydroxy-3-methylidenepiperidin-1-yl]-3-methylbutan-1-one |
| SMILES | C=C1CN(C(=O)[C@H](N)C(C)C)CC[C@]1(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-11(2)15(19)16(21)20-9-8-17(22,12(3)10-20)13-4-6-14(18)7-5-13/h4-7,11,15,22H,3,8-10,19H2,1-2H3/t15-,17-/m1/s1 |
| InChIKey | UASSGNOVKMEQIM-NVXWUHKLSA-N |
| XLogP | 2.30 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|